C12H14O2 — CID 2253109
(2E,4E)-5-(4-methoxyphenyl)penta-2,4-dien-1-ol (PubChem CID 2253109) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (2E,4E)-5-(4-methoxyphenyl)penta-2,4-dien-1-ol.
| Compound Name | (2E,4E)-5-(4-methoxyphenyl)penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 2253109 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (2E,4E)-5-(4-methoxyphenyl)penta-2,4-dien-1-ol |
| SMILES | COc1ccc(/C=C/C=C/CO)cc1 |
| InChI | InChI=1S/C12H14O2/c1-14-12-8-6-11(7-9-12)5-3-2-4-10-13/h2-9,13H,10H2,1H3/b4-2+,5-3+ |
| InChIKey | JYYGXXKNVIOVOV-ZUVMSYQZSA-N |
| XLogP | 2.26 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|