C13H14O2 — CID 89171740
(3E,5E)-6-(4-methoxyphenyl)hexa-1,3,5-trien-2-ol (PubChem CID 89171740) has the molecular formula C13H14O2 and a molecular weight of 202.25 g/mol. Its IUPAC name is (3E,5E)-6-(4-methoxyphenyl)hexa-1,3,5-trien-2-ol.
| Compound Name | (3E,5E)-6-(4-methoxyphenyl)hexa-1,3,5-trien-2-ol |
|---|---|
| PubChem CID | 89171740 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | (3E,5E)-6-(4-methoxyphenyl)hexa-1,3,5-trien-2-ol |
| SMILES | C=C(O)/C=C/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H14O2/c1-11(14)5-3-4-6-12-7-9-13(15-2)10-8-12/h3-10,14H,1H2,2H3/b5-3+,6-4+ |
| InChIKey | YIVIGIZUEGDHOW-GGWOSOGESA-N |
| XLogP | 3.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|