C28H26O2 — CID 53491376
1,2-bis[(1E)-4-(4-methoxyphenyl)buta-1,3-dienyl]benzene (PubChem CID 53491376) has the molecular formula C28H26O2 and a molecular weight of 394.51 g/mol. Its IUPAC name is 1,2-bis[(1E)-4-(4-methoxyphenyl)buta-1,3-dienyl]benzene.
| Compound Name | 1,2-bis[(1E)-4-(4-methoxyphenyl)buta-1,3-dienyl]benzene |
|---|---|
| PubChem CID | 53491376 |
| Molecular Formula | C28H26O2 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 1,2-bis[(1E)-4-(4-methoxyphenyl)buta-1,3-dienyl]benzene |
| SMILES | COc1ccc(C=C/C=C/c2ccccc2/C=C/C=Cc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C28H26O2/c1-29-27-19-15-23(16-20-27)9-3-5-11-25-13-7-8-14-26(25)12-6-4-10-24-17-21-28(30-2)22-18-24/h3-22H,1-2H3/b9-3?,10-4?,11-5+,12-6+ |
| InChIKey | SIMFOIWTSKANEW-XAYHOBPFSA-N |
| XLogP | 7.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|