C16H15NO — CID 87145440
2-[(1E,3E)-4-(4-methoxyphenyl)buta-1,3-dienyl]pyridine (PubChem CID 87145440) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is 2-[(1E,3E)-4-(4-methoxyphenyl)buta-1,3-dienyl]pyridine.
| Compound Name | 2-[(1E,3E)-4-(4-methoxyphenyl)buta-1,3-dienyl]pyridine |
|---|---|
| PubChem CID | 87145440 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | 2-[(1E,3E)-4-(4-methoxyphenyl)buta-1,3-dienyl]pyridine |
| SMILES | COc1ccc(/C=C/C=C/c2ccccn2)cc1 |
| InChI | InChI=1S/C16H15NO/c1-18-16-11-9-14(10-12-16)6-2-3-7-15-8-4-5-13-17-15/h2-13H,1H3/b6-2+,7-3+ |
| InChIKey | JBQCTYOYVYMCGJ-YPCIICBESA-N |
| XLogP | 3.82 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|