C18H15ClO2 — CID 71384226
5-(4-chlorophenyl)-1-(4-methoxyphenyl)penta-2,4-dien-1-one (PubChem CID 71384226) has the molecular formula C18H15ClO2 and a molecular weight of 298.77 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-1-(4-methoxyphenyl)penta-2,4-dien-1-one.
| Compound Name | 5-(4-chlorophenyl)-1-(4-methoxyphenyl)penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 71384226 |
| Molecular Formula | C18H15ClO2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 5-(4-chlorophenyl)-1-(4-methoxyphenyl)penta-2,4-dien-1-one |
| SMILES | COc1ccc(C(=O)C=CC=Cc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H15ClO2/c1-21-17-12-8-15(9-13-17)18(20)5-3-2-4-14-6-10-16(19)11-7-14/h2-13H,1H3 |
| InChIKey | RVKSYROVXJPOGG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|