C17H13ClO3 — CID 102100444
(E)-1-(4-chlorophenyl)-4-(4-methoxyphenyl)but-2-ene-1,4-dione (PubChem CID 102100444) has the molecular formula C17H13ClO3 and a molecular weight of 300.74 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-4-(4-methoxyphenyl)but-2-ene-1,4-dione.
| Compound Name | (E)-1-(4-chlorophenyl)-4-(4-methoxyphenyl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 102100444 |
| Molecular Formula | C17H13ClO3 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-4-(4-methoxyphenyl)but-2-ene-1,4-dione |
| SMILES | COc1ccc(C(=O)/C=C/C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C17H13ClO3/c1-21-15-8-4-13(5-9-15)17(20)11-10-16(19)12-2-6-14(18)7-3-12/h2-11H,1H3/b11-10+ |
| InChIKey | KOWDFLLZKWDDAP-ZHACJKMWSA-N |
| XLogP | 3.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|