C22H27NO — CID 118630726
3-[4-[(1E,3E)-4-(4-methoxyphenyl)buta-1,3-dienyl]phenyl]pentan-3-amine (PubChem CID 118630726) has the molecular formula C22H27NO and a molecular weight of 321.46 g/mol. Its IUPAC name is 3-[4-[(1E,3E)-4-(4-methoxyphenyl)buta-1,3-dienyl]phenyl]pentan-3-amine.
| Compound Name | 3-[4-[(1E,3E)-4-(4-methoxyphenyl)buta-1,3-dienyl]phenyl]pentan-3-amine |
|---|---|
| PubChem CID | 118630726 |
| Molecular Formula | C22H27NO |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 3-[4-[(1E,3E)-4-(4-methoxyphenyl)buta-1,3-dienyl]phenyl]pentan-3-amine |
| SMILES | CCC(N)(CC)c1ccc(/C=C/C=C/c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C22H27NO/c1-4-22(23,5-2)20-14-10-18(11-15-20)8-6-7-9-19-12-16-21(24-3)17-13-19/h6-17H,4-5,23H2,1-3H3/b8-6+,9-7+ |
| InChIKey | YUUGGVAWBDGVJH-CDJQDVQCSA-N |
| XLogP | 5.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|