C13H22N2O — CID 43829907
2-(4-methoxyphenyl)-1-N,1-N-dimethylbutane-1,2-diamine (PubChem CID 43829907) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-N,1-N-dimethylbutane-1,2-diamine.
| Compound Name | 2-(4-methoxyphenyl)-1-N,1-N-dimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 43829907 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-N,1-N-dimethylbutane-1,2-diamine |
| SMILES | CCC(N)(CN(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H22N2O/c1-5-13(14,10-15(2)3)11-6-8-12(16-4)9-7-11/h6-9H,5,10,14H2,1-4H3 |
| InChIKey | UPJJALUOLCGKSZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |