C16H28N2O — CID 43829878
3-(4-methoxyphenyl)-4-N,4-N-dimethylheptane-3,4-diamine (PubChem CID 43829878) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-4-N,4-N-dimethylheptane-3,4-diamine.
| Compound Name | 3-(4-methoxyphenyl)-4-N,4-N-dimethylheptane-3,4-diamine |
|---|---|
| PubChem CID | 43829878 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 3-(4-methoxyphenyl)-4-N,4-N-dimethylheptane-3,4-diamine |
| SMILES | CCCC(N(C)C)C(N)(CC)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H28N2O/c1-6-8-15(18(3)4)16(17,7-2)13-9-11-14(19-5)12-10-13/h9-12,15H,6-8,17H2,1-5H3 |
| InChIKey | LXSKSLIBDIHIEA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |