C18H30N2O — CID 43829893
4-(4-methoxyphenyl)-5-N,5-N-dimethylnon-1-ene-4,5-diamine (PubChem CID 43829893) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-5-N,5-N-dimethylnon-1-ene-4,5-diamine.
| Compound Name | 4-(4-methoxyphenyl)-5-N,5-N-dimethylnon-1-ene-4,5-diamine |
|---|---|
| PubChem CID | 43829893 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 4-(4-methoxyphenyl)-5-N,5-N-dimethylnon-1-ene-4,5-diamine |
| SMILES | C=CCC(N)(c1ccc(OC)cc1)C(CCCC)N(C)C |
| InChI | InChI=1S/C18H30N2O/c1-6-8-9-17(20(3)4)18(19,14-7-2)15-10-12-16(21-5)13-11-15/h7,10-13,17H,2,6,8-9,14,19H2,1,3-5H3 |
| InChIKey | ODCFSHIBFXXTSH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|