C17H22N2O2 — CID 58794752
(2S)-1,1-bis(4-methoxyphenyl)propane-1,2-diamine (PubChem CID 58794752) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (2S)-1,1-bis(4-methoxyphenyl)propane-1,2-diamine.
| Compound Name | (2S)-1,1-bis(4-methoxyphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 58794752 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (2S)-1,1-bis(4-methoxyphenyl)propane-1,2-diamine |
| SMILES | COc1ccc(C(N)(c2ccc(OC)cc2)[C@H](C)N)cc1 |
| InChI | InChI=1S/C17H22N2O2/c1-12(18)17(19,13-4-8-15(20-2)9-5-13)14-6-10-16(21-3)11-7-14/h4-12H,18-19H2,1-3H3/t12-/m0/s1 |
| InChIKey | FUIAQGXJJSEAJH-LBPRGKRZSA-N |
| XLogP | 2.25 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |