C21H30N2O4 — CID 22501160
1,1-bis(3,5-dimethoxyphenyl)-3-methylbutane-1,2-diamine (PubChem CID 22501160) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 1,1-bis(3,5-dimethoxyphenyl)-3-methylbutane-1,2-diamine.
| Compound Name | 1,1-bis(3,5-dimethoxyphenyl)-3-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 22501160 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 1,1-bis(3,5-dimethoxyphenyl)-3-methylbutane-1,2-diamine |
| SMILES | COc1cc(OC)cc(C(N)(c2cc(OC)cc(OC)c2)C(N)C(C)C)c1 |
| InChI | InChI=1S/C21H30N2O4/c1-13(2)20(22)21(23,14-7-16(24-3)11-17(8-14)25-4)15-9-18(26-5)12-19(10-15)27-6/h7-13,20H,22-23H2,1-6H3 |
| InChIKey | FDKRQSRPDUISLE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |