C19H20F6N2 — CID 102414149
(2S)-3-methyl-1,1-bis[4-(trifluoromethyl)phenyl]butane-1,2-diamine (PubChem CID 102414149) has the molecular formula C19H20F6N2 and a molecular weight of 390.37 g/mol. Its IUPAC name is (2S)-3-methyl-1,1-bis[4-(trifluoromethyl)phenyl]butane-1,2-diamine.
| Compound Name | (2S)-3-methyl-1,1-bis[4-(trifluoromethyl)phenyl]butane-1,2-diamine |
|---|---|
| PubChem CID | 102414149 |
| Molecular Formula | C19H20F6N2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (2S)-3-methyl-1,1-bis[4-(trifluoromethyl)phenyl]butane-1,2-diamine |
| SMILES | CC(C)[C@H](N)C(N)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H20F6N2/c1-11(2)16(26)17(27,12-3-7-14(8-4-12)18(20,21)22)13-5-9-15(10-6-13)19(23,24)25/h3-11,16H,26-27H2,1-2H3/t16-/m0/s1 |
| InChIKey | ZDYQYUWYLLYDFI-INIZCTEOSA-N |
| XLogP | 4.91 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |