C20H28N2O2 — CID 22486859
1,1-bis(4-methoxyphenyl)-4-methylpentane-1,2-diamine (PubChem CID 22486859) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1,1-bis(4-methoxyphenyl)-4-methylpentane-1,2-diamine.
| Compound Name | 1,1-bis(4-methoxyphenyl)-4-methylpentane-1,2-diamine |
|---|---|
| PubChem CID | 22486859 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1,1-bis(4-methoxyphenyl)-4-methylpentane-1,2-diamine |
| SMILES | COc1ccc(C(N)(c2ccc(OC)cc2)C(N)CC(C)C)cc1 |
| InChI | InChI=1S/C20H28N2O2/c1-14(2)13-19(21)20(22,15-5-9-17(23-3)10-6-15)16-7-11-18(24-4)12-8-16/h5-12,14,19H,13,21-22H2,1-4H3 |
| InChIKey | RYEKIQZUTHKUKD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |