C15H24O — CID 121309447
1-(2,5-dimethylhexan-2-yl)-4-methoxybenzene (PubChem CID 121309447) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-(2,5-dimethylhexan-2-yl)-4-methoxybenzene.
| Compound Name | 1-(2,5-dimethylhexan-2-yl)-4-methoxybenzene |
|---|---|
| PubChem CID | 121309447 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-(2,5-dimethylhexan-2-yl)-4-methoxybenzene |
| SMILES | COc1ccc(C(C)(C)CCC(C)C)cc1 |
| InChI | InChI=1S/C15H24O/c1-12(2)10-11-15(3,4)13-6-8-14(16-5)9-7-13/h6-9,12H,10-11H2,1-5H3 |
| InChIKey | IGVXYYGMLZJQKC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |