C15H25NO4 — CID 114358190
3-amino-2-(3,5-dimethoxyphenoxy)-4,4-dimethylpentan-1-ol (PubChem CID 114358190) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-amino-2-(3,5-dimethoxyphenoxy)-4,4-dimethylpentan-1-ol.
| Compound Name | 3-amino-2-(3,5-dimethoxyphenoxy)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 114358190 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 3-amino-2-(3,5-dimethoxyphenoxy)-4,4-dimethylpentan-1-ol |
| SMILES | COc1cc(OC)cc(OC(CO)C(N)C(C)(C)C)c1 |
| InChI | InChI=1S/C15H25NO4/c1-15(2,3)14(16)13(9-17)20-12-7-10(18-4)6-11(8-12)19-5/h6-8,13-14,17H,9,16H2,1-5H3 |
| InChIKey | JTGQRZDPGHODBW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |