C17H29NO2 — CID 114357898
3-amino-2-(4-tert-butylphenoxy)-4,4-dimethylpentan-1-ol (PubChem CID 114357898) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 3-amino-2-(4-tert-butylphenoxy)-4,4-dimethylpentan-1-ol.
| Compound Name | 3-amino-2-(4-tert-butylphenoxy)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 114357898 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 3-amino-2-(4-tert-butylphenoxy)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(C)c1ccc(OC(CO)C(N)C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H29NO2/c1-16(2,3)12-7-9-13(10-8-12)20-14(11-19)15(18)17(4,5)6/h7-10,14-15,19H,11,18H2,1-6H3 |
| InChIKey | SBDHFDXQMLCCLA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |