C11H15F2NO3 — CID 171239433
(3R)-3-amino-3-(3,5-dimethoxyphenyl)-2,2-difluoropropan-1-ol (PubChem CID 171239433) has the molecular formula C11H15F2NO3 and a molecular weight of 247.24 g/mol. Its IUPAC name is (3R)-3-amino-3-(3,5-dimethoxyphenyl)-2,2-difluoropropan-1-ol.
| Compound Name | (3R)-3-amino-3-(3,5-dimethoxyphenyl)-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 171239433 |
| Molecular Formula | C11H15F2NO3 |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | (3R)-3-amino-3-(3,5-dimethoxyphenyl)-2,2-difluoropropan-1-ol |
| SMILES | COc1cc(OC)cc([C@@H](N)C(F)(F)CO)c1 |
| InChI | InChI=1S/C11H15F2NO3/c1-16-8-3-7(4-9(5-8)17-2)10(14)11(12,13)6-15/h3-5,10,15H,6,14H2,1-2H3/t10-/m1/s1 |
| InChIKey | FRXRKMHXLUVCRL-SNVBAGLBSA-N |
| XLogP | 1.33 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |