C9H9ClF5NO — CID 171248283
(3S)-3-amino-2,2-difluoro-3-(3,4,5-trifluorophenyl)propan-1-ol;hydrochloride (PubChem CID 171248283) has the molecular formula C9H9ClF5NO and a molecular weight of 277.62 g/mol. Its IUPAC name is (3S)-3-amino-2,2-difluoro-3-(3,4,5-trifluorophenyl)propan-1-ol;hydrochloride.
| Compound Name | (3S)-3-amino-2,2-difluoro-3-(3,4,5-trifluorophenyl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171248283 |
| Molecular Formula | C9H9ClF5NO |
| Molecular Weight | 277.62 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | (3S)-3-amino-2,2-difluoro-3-(3,4,5-trifluorophenyl)propan-1-ol;hydrochloride |
| SMILES | Cl.N[C@@H](c1cc(F)c(F)c(F)c1)C(F)(F)CO |
| InChI | InChI=1S/C9H8F5NO.ClH/c10-5-1-4(2-6(11)7(5)12)8(15)9(13,14)3-16;/h1-2,8,16H,3,15H2;1H/t8-;/m0./s1 |
| InChIKey | KPMGSZJLFKIZOI-QRPNPIFTSA-N |
| XLogP | 2.15 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.62 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|