C9H8F5NO — CID 131611321
(3R)-3-amino-2,2-difluoro-3-(2,3,5-trifluorophenyl)propan-1-ol (PubChem CID 131611321) has the molecular formula C9H8F5NO and a molecular weight of 241.16 g/mol. Its IUPAC name is (3R)-3-amino-2,2-difluoro-3-(2,3,5-trifluorophenyl)propan-1-ol.
| Compound Name | (3R)-3-amino-2,2-difluoro-3-(2,3,5-trifluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 131611321 |
| Molecular Formula | C9H8F5NO |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 241.05 |
| IUPAC Name | (3R)-3-amino-2,2-difluoro-3-(2,3,5-trifluorophenyl)propan-1-ol |
| SMILES | N[C@H](c1cc(F)cc(F)c1F)C(F)(F)CO |
| InChI | InChI=1S/C9H8F5NO/c10-4-1-5(7(12)6(11)2-4)8(15)9(13,14)3-16/h1-2,8,16H,3,15H2/t8-/m1/s1 |
| InChIKey | SMRQDQYKWMXQRU-MRVPVSSYSA-N |
| XLogP | 1.73 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|