C10H12F3NO3 — CID 171256039
2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-4-fluoro-6-methoxyphenol (PubChem CID 171256039) has the molecular formula C10H12F3NO3 and a molecular weight of 251.20 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-4-fluoro-6-methoxyphenol.
| Compound Name | 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-4-fluoro-6-methoxyphenol |
|---|---|
| PubChem CID | 171256039 |
| Molecular Formula | C10H12F3NO3 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-4-fluoro-6-methoxyphenol |
| SMILES | COc1cc(F)cc([C@@H](N)C(F)(F)CO)c1O |
| InChI | InChI=1S/C10H12F3NO3/c1-17-7-3-5(11)2-6(8(7)16)9(14)10(12,13)4-15/h2-3,9,15-16H,4,14H2,1H3/t9-/m1/s1 |
| InChIKey | LWZDPIXTMFHFRC-SECBINFHSA-N |
| XLogP | 1.17 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|