C9H5F8N — CID 171312383
(1R)-2,2,3,3,3-pentafluoro-1-(3,4,5-trifluorophenyl)propan-1-amine (PubChem CID 171312383) has the molecular formula C9H5F8N and a molecular weight of 279.13 g/mol. Its IUPAC name is (1R)-2,2,3,3,3-pentafluoro-1-(3,4,5-trifluorophenyl)propan-1-amine.
| Compound Name | (1R)-2,2,3,3,3-pentafluoro-1-(3,4,5-trifluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 171312383 |
| Molecular Formula | C9H5F8N |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 279.03 |
| IUPAC Name | (1R)-2,2,3,3,3-pentafluoro-1-(3,4,5-trifluorophenyl)propan-1-amine |
| SMILES | N[C@H](c1cc(F)c(F)c(F)c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H5F8N/c10-4-1-3(2-5(11)6(4)12)7(18)8(13,14)9(15,16)17/h1-2,7H,18H2/t7-/m1/s1 |
| InChIKey | OVNNUJFUTVPYQS-SSDOTTSWSA-N |
| XLogP | 3.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|