C11H11Cl2F6NO — CID 171311983
(1S)-1-(3-chloro-4-ethoxy-5-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride (PubChem CID 171311983) has the molecular formula C11H11Cl2F6NO and a molecular weight of 358.11 g/mol. Its IUPAC name is (1S)-1-(3-chloro-4-ethoxy-5-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(3-chloro-4-ethoxy-5-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171311983 |
| Molecular Formula | C11H11Cl2F6NO |
| Molecular Weight | 358.11 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | (1S)-1-(3-chloro-4-ethoxy-5-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
| SMILES | CCOc1c(F)cc([C@H](N)C(F)(F)C(F)(F)F)cc1Cl.Cl |
| InChI | InChI=1S/C11H10ClF6NO.ClH/c1-2-20-8-6(12)3-5(4-7(8)13)9(19)10(14,15)11(16,17)18;/h3-4,9H,2,19H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | FPAGIAOXLICRFA-FVGYRXGTSA-N |
| XLogP | 4.50 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.11 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|