C15H22Cl2FNO — CID 171234582
(S)-(3-chloro-4-ethoxy-5-fluorophenyl)-cyclohexylmethanamine;hydrochloride (PubChem CID 171234582) has the molecular formula C15H22Cl2FNO and a molecular weight of 322.25 g/mol. Its IUPAC name is (S)-(3-chloro-4-ethoxy-5-fluorophenyl)-cyclohexylmethanamine;hydrochloride.
| Compound Name | (S)-(3-chloro-4-ethoxy-5-fluorophenyl)-cyclohexylmethanamine;hydrochloride |
|---|---|
| PubChem CID | 171234582 |
| Molecular Formula | C15H22Cl2FNO |
| Molecular Weight | 322.25 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | (S)-(3-chloro-4-ethoxy-5-fluorophenyl)-cyclohexylmethanamine;hydrochloride |
| SMILES | CCOc1c(F)cc([C@@H](N)C2CCCCC2)cc1Cl.Cl |
| InChI | InChI=1S/C15H21ClFNO.ClH/c1-2-19-15-12(16)8-11(9-13(15)17)14(18)10-6-4-3-5-7-10;/h8-10,14H,2-7,18H2,1H3;1H/t14-;/m0./s1 |
| InChIKey | OABFWEXDZDTLAP-UQKRIMTDSA-N |
| XLogP | 4.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.25 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |