C19H28ClFN2O — CID 171167483
1-[(S)-(3-chloro-4-ethoxy-5-fluorophenyl)-cyclohexylmethyl]piperazine (PubChem CID 171167483) has the molecular formula C19H28ClFN2O and a molecular weight of 354.90 g/mol. Its IUPAC name is 1-[(S)-(3-chloro-4-ethoxy-5-fluorophenyl)-cyclohexylmethyl]piperazine.
| Compound Name | 1-[(S)-(3-chloro-4-ethoxy-5-fluorophenyl)-cyclohexylmethyl]piperazine |
|---|---|
| PubChem CID | 171167483 |
| Molecular Formula | C19H28ClFN2O |
| Molecular Weight | 354.90 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-[(S)-(3-chloro-4-ethoxy-5-fluorophenyl)-cyclohexylmethyl]piperazine |
| SMILES | CCOc1c(F)cc([C@H](C2CCCCC2)N2CCNCC2)cc1Cl |
| InChI | InChI=1S/C19H28ClFN2O/c1-2-24-19-16(20)12-15(13-17(19)21)18(14-6-4-3-5-7-14)23-10-8-22-9-11-23/h12-14,18,22H,2-11H2,1H3/t18-/m0/s1 |
| InChIKey | QBFANOXZAFZIQN-SFHVURJKSA-N |
| XLogP | 4.40 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.90 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |