C18H28ClFN2O — CID 171310503
1-[(1S)-1-(3-chloro-4-ethoxy-5-fluorophenyl)-4-methylpentyl]piperazine (PubChem CID 171310503) has the molecular formula C18H28ClFN2O and a molecular weight of 342.89 g/mol. Its IUPAC name is 1-[(1S)-1-(3-chloro-4-ethoxy-5-fluorophenyl)-4-methylpentyl]piperazine.
| Compound Name | 1-[(1S)-1-(3-chloro-4-ethoxy-5-fluorophenyl)-4-methylpentyl]piperazine |
|---|---|
| PubChem CID | 171310503 |
| Molecular Formula | C18H28ClFN2O |
| Molecular Weight | 342.89 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-[(1S)-1-(3-chloro-4-ethoxy-5-fluorophenyl)-4-methylpentyl]piperazine |
| SMILES | CCOc1c(F)cc([C@H](CCC(C)C)N2CCNCC2)cc1Cl |
| InChI | InChI=1S/C18H28ClFN2O/c1-4-23-18-15(19)11-14(12-16(18)20)17(6-5-13(2)3)22-9-7-21-8-10-22/h11-13,17,21H,4-10H2,1-3H3/t17-/m0/s1 |
| InChIKey | WNLHAIUAJMJCPI-KRWDZBQOSA-N |
| XLogP | 4.26 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.89 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |