C17H24ClFN2O — CID 171177883
1-[(R)-(3-chloro-4-ethoxy-5-fluorophenyl)-cyclobutylmethyl]piperazine (PubChem CID 171177883) has the molecular formula C17H24ClFN2O and a molecular weight of 326.84 g/mol. Its IUPAC name is 1-[(R)-(3-chloro-4-ethoxy-5-fluorophenyl)-cyclobutylmethyl]piperazine.
| Compound Name | 1-[(R)-(3-chloro-4-ethoxy-5-fluorophenyl)-cyclobutylmethyl]piperazine |
|---|---|
| PubChem CID | 171177883 |
| Molecular Formula | C17H24ClFN2O |
| Molecular Weight | 326.84 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-[(R)-(3-chloro-4-ethoxy-5-fluorophenyl)-cyclobutylmethyl]piperazine |
| SMILES | CCOc1c(F)cc([C@@H](C2CCC2)N2CCNCC2)cc1Cl |
| InChI | InChI=1S/C17H24ClFN2O/c1-2-22-17-14(18)10-13(11-15(17)19)16(12-4-3-5-12)21-8-6-20-7-9-21/h10-12,16,20H,2-9H2,1H3/t16-/m1/s1 |
| InChIKey | NASCUXVFLHUZSL-MRXNPFEDSA-N |
| XLogP | 3.62 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.84 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |