C8H6ClF6N — CID 171248276
(1S)-2,2,2-trifluoro-1-(3,4,5-trifluorophenyl)ethanamine;hydrochloride (PubChem CID 171248276) has the molecular formula C8H6ClF6N and a molecular weight of 265.58 g/mol. Its IUPAC name is (1S)-2,2,2-trifluoro-1-(3,4,5-trifluorophenyl)ethanamine;hydrochloride.
| Compound Name | (1S)-2,2,2-trifluoro-1-(3,4,5-trifluorophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 171248276 |
| Molecular Formula | C8H6ClF6N |
| Molecular Weight | 265.58 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | (1S)-2,2,2-trifluoro-1-(3,4,5-trifluorophenyl)ethanamine;hydrochloride |
| SMILES | Cl.N[C@@H](c1cc(F)c(F)c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C8H5F6N.ClH/c9-4-1-3(2-5(10)6(4)11)7(15)8(12,13)14;/h1-2,7H,15H2;1H/t7-;/m0./s1 |
| InChIKey | ROKZXWMFWVENIV-FJXQXJEOSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.58 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|