C9H7Cl2F6N — CID 171311631
(1S)-1-(3-chloro-5-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride (PubChem CID 171311631) has the molecular formula C9H7Cl2F6N and a molecular weight of 314.06 g/mol. Its IUPAC name is (1S)-1-(3-chloro-5-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(3-chloro-5-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171311631 |
| Molecular Formula | C9H7Cl2F6N |
| Molecular Weight | 314.06 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | (1S)-1-(3-chloro-5-fluorophenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
| SMILES | Cl.N[C@@H](c1cc(F)cc(Cl)c1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6ClF6N.ClH/c10-5-1-4(2-6(11)3-5)7(17)8(12,13)9(14,15)16;/h1-3,7H,17H2;1H/t7-;/m0./s1 |
| InChIKey | IDRPYRBLAOKTHJ-FJXQXJEOSA-N |
| XLogP | 4.10 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.06 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|