C17H28N2O2 — CID 167148594
N'-[(3R)-2,2-dimethylhexan-3-yl]-4-methoxy-N'-methylbenzohydrazide (PubChem CID 167148594) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is N'-[(3R)-2,2-dimethylhexan-3-yl]-4-methoxy-N'-methylbenzohydrazide.
| Compound Name | N'-[(3R)-2,2-dimethylhexan-3-yl]-4-methoxy-N'-methylbenzohydrazide |
|---|---|
| PubChem CID | 167148594 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | N'-[(3R)-2,2-dimethylhexan-3-yl]-4-methoxy-N'-methylbenzohydrazide |
| SMILES | CCC[C@@H](N(C)NC(=O)c1ccc(OC)cc1)C(C)(C)C |
| InChI | InChI=1S/C17H28N2O2/c1-7-8-15(17(2,3)4)19(5)18-16(20)13-9-11-14(21-6)12-10-13/h9-12,15H,7-8H2,1-6H3,(H,18,20)/t15-/m1/s1 |
| InChIKey | DOCQZWIAMUFYQL-OAHLLOKOSA-N |
| XLogP | 3.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|