About ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene
ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene (PubChem CID 159851450) has the molecular formula C19H25NO
and a molecular weight of 283.42 g/mol. Its IUPAC name is ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene.
Molecular Properties
| Compound Name | ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene |
| PubChem CID | 159851450 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene |
| SMILES | CCN.CCc1ccc(/C=C/c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C17H18O.C2H7N/c1-3-14-4-6-15(7-5-14)8-9-16-10-12-17(18-2)13-11-16;1-2-3/h4-13H,3H2,1-2H3;2-3H2,1H3/b9-8+; |
| InChIKey | NPZJVJHXFBZKFP-HRNDJLQDSA-N |
| XLogP | 4.39 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene?
The IUPAC name of ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene (CID 159851450) is ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene.
What is the SMILES notation for ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene?
The canonical SMILES for ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene is CCN.CCc1ccc(/C=C/c2ccc(OC)cc2)cc1.
What is the InChIKey of ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene?
The InChIKey is NPZJVJHXFBZKFP-HRNDJLQDSA-N. The full InChI is InChI=1S/C17H18O.C2H7N/c1-3-14-4-6-15(7-5-14)8-9-16-10-12-17(18-2)13-11-16;1-2-3/h4-13H,3H2,1-2H3;2-3H2,1H3/b9-8+;.
What are the key properties of ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene?
ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene has a molecular weight of 283.42 g/mol, XLogP of 4.39, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;1-ethyl-4-[(E)-2-(4-methoxyphenyl)ethenyl]benzene is sourced from PubChem (CID 159851450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).