About ethanamine;1-methoxy-4-propylbenzene
ethanamine;1-methoxy-4-propylbenzene (PubChem CID 19382800) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is ethanamine;1-methoxy-4-propylbenzene.
Molecular Properties
| Compound Name | ethanamine;1-methoxy-4-propylbenzene |
| PubChem CID | 19382800 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | ethanamine;1-methoxy-4-propylbenzene |
| SMILES | CCCc1ccc(OC)cc1.CCN |
| InChI | InChI=1S/C10H14O.C2H7N/c1-3-4-9-5-7-10(11-2)8-6-9;1-2-3/h5-8H,3-4H2,1-2H3;2-3H2,1H3 |
| InChIKey | LLXOIUVPGYGIST-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanamine;1-methoxy-4-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;1-methoxy-4-propylbenzene?
The IUPAC name of ethanamine;1-methoxy-4-propylbenzene (CID 19382800) is ethanamine;1-methoxy-4-propylbenzene.
What is the SMILES notation for ethanamine;1-methoxy-4-propylbenzene?
The canonical SMILES for ethanamine;1-methoxy-4-propylbenzene is CCCc1ccc(OC)cc1.CCN.
What is the InChIKey of ethanamine;1-methoxy-4-propylbenzene?
The InChIKey is LLXOIUVPGYGIST-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C2H7N/c1-3-4-9-5-7-10(11-2)8-6-9;1-2-3/h5-8H,3-4H2,1-2H3;2-3H2,1H3.
What are the key properties of ethanamine;1-methoxy-4-propylbenzene?
ethanamine;1-methoxy-4-propylbenzene has a molecular weight of 195.31 g/mol, XLogP of 2.61, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;1-methoxy-4-propylbenzene is sourced from PubChem (CID 19382800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).