About (4-propylphenyl) hypochlorite
(4-propylphenyl) hypochlorite (PubChem CID 175330115) has the molecular formula C9H11ClO
and a molecular weight of 170.64 g/mol. Its IUPAC name is (4-propylphenyl) hypochlorite.
Molecular Properties
| Compound Name | (4-propylphenyl) hypochlorite |
| PubChem CID | 175330115 |
| Molecular Formula | C9H11ClO |
| Molecular Weight | 170.64 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | (4-propylphenyl) hypochlorite |
| SMILES | CCCc1ccc(OCl)cc1 |
| InChI | InChI=1S/C9H11ClO/c1-2-3-8-4-6-9(11-10)7-5-8/h4-7H,2-3H2,1H3 |
| InChIKey | NOXXRFFNWXQWSA-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.64 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4-propylphenyl) hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propylphenyl) hypochlorite?
The IUPAC name of (4-propylphenyl) hypochlorite (CID 175330115) is (4-propylphenyl) hypochlorite.
What is the SMILES notation for (4-propylphenyl) hypochlorite?
The canonical SMILES for (4-propylphenyl) hypochlorite is CCCc1ccc(OCl)cc1.
What is the InChIKey of (4-propylphenyl) hypochlorite?
The InChIKey is NOXXRFFNWXQWSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO/c1-2-3-8-4-6-9(11-10)7-5-8/h4-7H,2-3H2,1H3.
What are the key properties of (4-propylphenyl) hypochlorite?
(4-propylphenyl) hypochlorite has a molecular weight of 170.64 g/mol, XLogP of 3.17, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propylphenyl) hypochlorite is sourced from PubChem (CID 175330115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).