About (4-propylphenyl)sulfanyl hypochlorite
(4-propylphenyl)sulfanyl hypochlorite (PubChem CID 143539477) has the molecular formula C9H11ClOS
and a molecular weight of 202.71 g/mol. Its IUPAC name is (4-propylphenyl)sulfanyl hypochlorite.
Molecular Properties
| Compound Name | (4-propylphenyl)sulfanyl hypochlorite |
| PubChem CID | 143539477 |
| Molecular Formula | C9H11ClOS |
| Molecular Weight | 202.71 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | (4-propylphenyl)sulfanyl hypochlorite |
| SMILES | CCCc1ccc(SOCl)cc1 |
| InChI | InChI=1S/C9H11ClOS/c1-2-3-8-4-6-9(7-5-8)12-11-10/h4-7H,2-3H2,1H3 |
| InChIKey | OBZUVXBWIHNIMZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.71 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-propylphenyl)sulfanyl hypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propylphenyl)sulfanyl hypochlorite?
The IUPAC name of (4-propylphenyl)sulfanyl hypochlorite (CID 143539477) is (4-propylphenyl)sulfanyl hypochlorite.
What is the SMILES notation for (4-propylphenyl)sulfanyl hypochlorite?
The canonical SMILES for (4-propylphenyl)sulfanyl hypochlorite is CCCc1ccc(SOCl)cc1.
What is the InChIKey of (4-propylphenyl)sulfanyl hypochlorite?
The InChIKey is OBZUVXBWIHNIMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClOS/c1-2-3-8-4-6-9(7-5-8)12-11-10/h4-7H,2-3H2,1H3.
What are the key properties of (4-propylphenyl)sulfanyl hypochlorite?
(4-propylphenyl)sulfanyl hypochlorite has a molecular weight of 202.71 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propylphenyl)sulfanyl hypochlorite is sourced from PubChem (CID 143539477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).