C17H16I2O — CID 134546040
1-[2-(4-ethylphenyl)ethenyl]-2,3-diiodo-4-methoxybenzene (PubChem CID 134546040) has the molecular formula C17H16I2O and a molecular weight of 490.12 g/mol. Its IUPAC name is 1-[2-(4-ethylphenyl)ethenyl]-2,3-diiodo-4-methoxybenzene.
| Compound Name | 1-[2-(4-ethylphenyl)ethenyl]-2,3-diiodo-4-methoxybenzene |
|---|---|
| PubChem CID | 134546040 |
| Molecular Formula | C17H16I2O |
| Molecular Weight | 490.12 g/mol |
| Exact Mass | 489.93 |
| IUPAC Name | 1-[2-(4-ethylphenyl)ethenyl]-2,3-diiodo-4-methoxybenzene |
| SMILES | CCc1ccc(C=Cc2ccc(OC)c(I)c2I)cc1 |
| InChI | InChI=1S/C17H16I2O/c1-3-12-4-6-13(7-5-12)8-9-14-10-11-15(20-2)17(19)16(14)18/h4-11H,3H2,1-2H3 |
| InChIKey | XCYCWGPUYUPKOS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.12 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|