C17H21INO2+ — CID 126960054
4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium;hydroiodide (PubChem CID 126960054) has the molecular formula C17H21INO2+ and a molecular weight of 398.26 g/mol. Its IUPAC name is 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium;hydroiodide.
| Compound Name | 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium;hydroiodide |
|---|---|
| PubChem CID | 126960054 |
| Molecular Formula | C17H21INO2+ |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | 4-[2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium;hydroiodide |
| SMILES | CC[n+]1ccc(C=Cc2ccc(OC)c(OC)c2)cc1.I |
| InChI | InChI=1S/C17H20NO2.HI/c1-4-18-11-9-14(10-12-18)5-6-15-7-8-16(19-2)17(13-15)20-3;/h5-13H,4H2,1-3H3;1H/q+1; |
| InChIKey | AOIZQTZKNUDNOX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|