C17H20NO2+ — CID 5105203
2-[2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium (PubChem CID 5105203) has the molecular formula C17H20NO2+ and a molecular weight of 270.35 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium |
|---|---|
| PubChem CID | 5105203 |
| Molecular Formula | C17H20NO2+ |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium |
| SMILES | CC[n+]1ccccc1C=Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C17H20NO2/c1-4-18-12-6-5-7-15(18)10-8-14-9-11-16(19-2)17(13-14)20-3/h5-13H,4H2,1-3H3/q+1 |
| InChIKey | TXPQICNVODYCSE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|