C21H30N3+ — CID 143547026
N'-[4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]phenyl]-N,N,N'-trimethylpropane-1,3-diamine (PubChem CID 143547026) has the molecular formula C21H30N3+ and a molecular weight of 324.49 g/mol. Its IUPAC name is N'-[4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]phenyl]-N,N,N'-trimethylpropane-1,3-diamine.
| Compound Name | N'-[4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]phenyl]-N,N,N'-trimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 143547026 |
| Molecular Formula | C21H30N3+ |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | N'-[4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]phenyl]-N,N,N'-trimethylpropane-1,3-diamine |
| SMILES | CC[n+]1ccccc1/C=C/c1ccc(N(C)CCCN(C)C)cc1 |
| InChI | InChI=1S/C21H30N3/c1-5-24-18-7-6-9-21(24)15-12-19-10-13-20(14-11-19)23(4)17-8-16-22(2)3/h6-7,9-15,18H,5,8,16-17H2,1-4H3/q+1 |
| InChIKey | VUXSJWBPOFFMNI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|