C17H20INO2 — CID 45049537
2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium iodide (PubChem CID 45049537) has the molecular formula C17H20INO2 and a molecular weight of 397.26 g/mol. Its IUPAC name is 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium iodide.
| Compound Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium iodide |
|---|---|
| PubChem CID | 45049537 |
| Molecular Formula | C17H20INO2 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]-1-ethylpyridin-1-ium iodide |
| SMILES | CC[n+]1ccccc1/C=C/c1ccc(OC)c(OC)c1.[I-] |
| InChI | InChI=1S/C17H20NO2.HI/c1-4-18-12-6-5-7-15(18)10-8-14-9-11-16(19-2)17(13-14)20-3;/h5-13H,4H2,1-3H3;1H/q+1;/p-1/b10-8+; |
| InChIKey | RRVOBUVXCTYISU-VRTOBVRTSA-M |
| XLogP | 0.19 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|