C36H44Cl2N4 — CID 68819776
N-[4-[2-(1-ethylpyridin-1-ium-2-yl)ethenyl]phenyl]-N'-[4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]phenyl]-N,N'-dimethylbutane-1,4-diamine dichloride (PubChem CID 68819776) has the molecular formula C36H44Cl2N4 and a molecular weight of 603.68 g/mol. Its IUPAC name is N-[4-[2-(1-ethylpyridin-1-ium-2-yl)ethenyl]phenyl]-N'-[4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]phenyl]-N,N'-dimethylbutane-1,4-diamine dichloride.
| Compound Name | N-[4-[2-(1-ethylpyridin-1-ium-2-yl)ethenyl]phenyl]-N'-[4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]phenyl]-N,N'-dimethylbutane-1,4-diamine dichloride |
|---|---|
| PubChem CID | 68819776 |
| Molecular Formula | C36H44Cl2N4 |
| Molecular Weight | 603.68 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | N-[4-[2-(1-ethylpyridin-1-ium-2-yl)ethenyl]phenyl]-N'-[4-[(E)-2-(1-ethylpyridin-1-ium-2-yl)ethenyl]phenyl]-N,N'-dimethylbutane-1,4-diamine dichloride |
| SMILES | CC[n+]1ccccc1C=Cc1ccc(N(C)CCCCN(C)c2ccc(/C=C/c3cccc[n+]3CC)cc2)cc1.[Cl-].[Cl-] |
| InChI | InChI=1S/C36H44N4.2ClH/c1-5-39-29-9-7-13-35(39)25-19-31-15-21-33(22-16-31)37(3)27-11-12-28-38(4)34-23-17-32(18-24-34)20-26-36-14-8-10-30-40(36)6-2;;/h7-10,13-26,29-30H,5-6,11-12,27-28H2,1-4H3;2*1H/q+2;;/p-2 |
| InChIKey | DNAPECFKHQEIIF-UHFFFAOYSA-L |
| XLogP | 1.00 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.68 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|