C21H28BrN2+ — CID 69329119
4-[2-[1-(6-bromohexyl)pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 69329119) has the molecular formula C21H28BrN2+ and a molecular weight of 388.37 g/mol. Its IUPAC name is 4-[2-[1-(6-bromohexyl)pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[1-(6-bromohexyl)pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 69329119 |
| Molecular Formula | C21H28BrN2+ |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 4-[2-[1-(6-bromohexyl)pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C=Cc2cccc[n+]2CCCCCCBr)cc1 |
| InChI | InChI=1S/C21H28BrN2/c1-23(2)20-13-10-19(11-14-20)12-15-21-9-5-8-18-24(21)17-7-4-3-6-16-22/h5,8-15,18H,3-4,6-7,16-17H2,1-2H3/q+1 |
| InChIKey | QFWZQEINYUZTOM-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|