C34H41N5+2 — CID 163414891
4-[(E)-2-[1-[6-[3-(anilinomethyl)-4-methanimidoylpyridin-1-ium-1-yl]hexyl]pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline (PubChem CID 163414891) has the molecular formula C34H41N5+2 and a molecular weight of 519.74 g/mol. Its IUPAC name is 4-[(E)-2-[1-[6-[3-(anilinomethyl)-4-methanimidoylpyridin-1-ium-1-yl]hexyl]pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[1-[6-[3-(anilinomethyl)-4-methanimidoylpyridin-1-ium-1-yl]hexyl]pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 163414891 |
| Molecular Formula | C34H41N5+2 |
| Molecular Weight | 519.74 g/mol |
| Exact Mass | 519.34 |
| IUPAC Name | 4-[(E)-2-[1-[6-[3-(anilinomethyl)-4-methanimidoylpyridin-1-ium-1-yl]hexyl]pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylaniline |
| SMILES | [H]/N=C/c1cc[n+](CCCCCC[n+]2ccccc2/C=C/c2ccc(N(C)C)cc2)cc1CNc1ccccc1 |
| InChI | InChI=1S/C34H41N5/c1-37(2)33-18-15-29(16-19-33)17-20-34-14-8-11-24-39(34)23-10-4-3-9-22-38-25-21-30(26-35)31(28-38)27-36-32-12-6-5-7-13-32/h5-8,11-21,24-26,28,35-36H,3-4,9-10,22-23,27H2,1-2H3/q+2/b35-26+ |
| InChIKey | ADNXEDDSPVVUSN-MDAYZVFASA-N |
| XLogP | 6.37 |
| TPSA | 46.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.74 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|