C37H44N3S2+ — CID 89457613
4-[(E)-2-[2-[2-[4-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butyldisulfanyl]ethyl]phenyl]ethenyl]-N,N-dimethylaniline (PubChem CID 89457613) has the molecular formula C37H44N3S2+ and a molecular weight of 594.91 g/mol. Its IUPAC name is 4-[(E)-2-[2-[2-[4-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butyldisulfanyl]ethyl]phenyl]ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(E)-2-[2-[2-[4-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butyldisulfanyl]ethyl]phenyl]ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 89457613 |
| Molecular Formula | C37H44N3S2+ |
| Molecular Weight | 594.91 g/mol |
| Exact Mass | 594.30 |
| IUPAC Name | 4-[(E)-2-[2-[2-[4-[2-[(E)-2-[4-(dimethylamino)phenyl]ethenyl]pyridin-1-ium-1-yl]butyldisulfanyl]ethyl]phenyl]ethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C=C/c2ccccc2CCSSCCCC[n+]2ccccc2/C=C/c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C37H44N3S2/c1-38(2)35-21-15-31(16-22-35)14-20-33-11-5-6-12-34(33)26-30-42-41-29-10-9-28-40-27-8-7-13-37(40)25-19-32-17-23-36(24-18-32)39(3)4/h5-8,11-25,27H,9-10,26,28-30H2,1-4H3/q+1/b20-14+ |
| InChIKey | FHCPMDOIKIQGDF-XSFVSMFZSA-N |
| XLogP | 8.85 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.91 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|