C42H44N4S2+2 — CID 76595650
4-[2-[1-[2-[2-[2-[2-[4-(dimethylamino)naphthalen-1-yl]ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylnaphthalen-1-amine (PubChem CID 76595650) has the molecular formula C42H44N4S2+2 and a molecular weight of 668.98 g/mol. Its IUPAC name is 4-[2-[1-[2-[2-[2-[2-[4-(dimethylamino)naphthalen-1-yl]ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylnaphthalen-1-amine.
| Compound Name | 4-[2-[1-[2-[2-[2-[2-[4-(dimethylamino)naphthalen-1-yl]ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylnaphthalen-1-amine |
|---|---|
| PubChem CID | 76595650 |
| Molecular Formula | C42H44N4S2+2 |
| Molecular Weight | 668.98 g/mol |
| Exact Mass | 668.30 |
| IUPAC Name | 4-[2-[1-[2-[2-[2-[2-[4-(dimethylamino)naphthalen-1-yl]ethenyl]pyridin-1-ium-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium-2-yl]ethenyl]-N,N-dimethylnaphthalen-1-amine |
| SMILES | CN(C)c1ccc(C=Cc2cccc[n+]2CCSSCC[n+]2ccccc2C=Cc2ccc(N(C)C)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C42H44N4S2/c1-43(2)41-25-21-33(37-15-5-7-17-39(37)41)19-23-35-13-9-11-27-45(35)29-31-47-48-32-30-46-28-12-10-14-36(46)24-20-34-22-26-42(44(3)4)40-18-8-6-16-38(34)40/h5-28H,29-32H2,1-4H3/q+2 |
| InChIKey | KMUPVIYUUYWMDM-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 14.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.98 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|