C31H47ClN3S2+3 — CID 142469148
butyl(dimethyl)azanium;4-[2-[(E)-2-(4-chloronaphthalen-1-yl)ethenyl]pyridin-1-ium-1-yl]butyl-[2-(disulfanyl)ethyl]-dimethylazanium (PubChem CID 142469148) has the molecular formula C31H47ClN3S2+3 and a molecular weight of 561.33 g/mol. Its IUPAC name is butyl(dimethyl)azanium;4-[2-[(E)-2-(4-chloronaphthalen-1-yl)ethenyl]pyridin-1-ium-1-yl]butyl-[2-(disulfanyl)ethyl]-dimethylazanium.
| Compound Name | butyl(dimethyl)azanium;4-[2-[(E)-2-(4-chloronaphthalen-1-yl)ethenyl]pyridin-1-ium-1-yl]butyl-[2-(disulfanyl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 142469148 |
| Molecular Formula | C31H47ClN3S2+3 |
| Molecular Weight | 561.33 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | butyl(dimethyl)azanium;4-[2-[(E)-2-(4-chloronaphthalen-1-yl)ethenyl]pyridin-1-ium-1-yl]butyl-[2-(disulfanyl)ethyl]-dimethylazanium |
| SMILES | CCCC[NH+](C)C.C[N+](C)(CCCC[n+]1ccccc1/C=C/c1ccc(Cl)c2ccccc12)CCSS |
| InChI | InChI=1S/C25H30ClN2S2.C6H15N/c1-28(2,19-20-30-29)18-8-7-17-27-16-6-5-9-22(27)14-12-21-13-15-25(26)24-11-4-3-10-23(21)24;1-4-5-6-7(2)3/h3-6,9-16H,7-8,17-20H2,1-2H3;4-6H2,1-3H3/q+1;/p+2/b14-12+; |
| InChIKey | WYEMSZSLAZYMFI-UNGNXWFZSA-P |
| XLogP | 6.32 |
| TPSA | 8.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.33 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|