C20H26INS — CID 53396732
1-hexyl-2-[2-(4-methylsulfanylphenyl)ethenyl]pyridin-1-ium iodide (PubChem CID 53396732) has the molecular formula C20H26INS and a molecular weight of 439.41 g/mol. Its IUPAC name is 1-hexyl-2-[2-(4-methylsulfanylphenyl)ethenyl]pyridin-1-ium iodide.
| Compound Name | 1-hexyl-2-[2-(4-methylsulfanylphenyl)ethenyl]pyridin-1-ium iodide |
|---|---|
| PubChem CID | 53396732 |
| Molecular Formula | C20H26INS |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 1-hexyl-2-[2-(4-methylsulfanylphenyl)ethenyl]pyridin-1-ium iodide |
| SMILES | CCCCCC[n+]1ccccc1C=Cc1ccc(SC)cc1.[I-] |
| InChI | InChI=1S/C20H26NS.HI/c1-3-4-5-7-16-21-17-8-6-9-19(21)13-10-18-11-14-20(22-2)15-12-18;/h6,8-15,17H,3-5,7,16H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | RKCWHNGKCCRWJI-UHFFFAOYSA-M |
| XLogP | 2.45 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|