C24H33BrN2 — CID 70455196
1-hexyl-2-[2-(4-piperidin-1-ylphenyl)ethenyl]pyridin-1-ium bromide (PubChem CID 70455196) has the molecular formula C24H33BrN2 and a molecular weight of 429.45 g/mol. Its IUPAC name is 1-hexyl-2-[2-(4-piperidin-1-ylphenyl)ethenyl]pyridin-1-ium bromide.
| Compound Name | 1-hexyl-2-[2-(4-piperidin-1-ylphenyl)ethenyl]pyridin-1-ium bromide |
|---|---|
| PubChem CID | 70455196 |
| Molecular Formula | C24H33BrN2 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 1-hexyl-2-[2-(4-piperidin-1-ylphenyl)ethenyl]pyridin-1-ium bromide |
| SMILES | CCCCCC[n+]1ccccc1C=Cc1ccc(N2CCCCC2)cc1.[Br-] |
| InChI | InChI=1S/C24H33N2.BrH/c1-2-3-4-7-18-25-21-10-6-11-23(25)15-12-22-13-16-24(17-14-22)26-19-8-5-9-20-26;/h6,10-17,21H,2-5,7-9,18-20H2,1H3;1H/q+1;/p-1 |
| InChIKey | YVKUPROAXYENAP-UHFFFAOYSA-M |
| XLogP | 2.72 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|