C26H33N2+ — CID 23534262
1-butyl-3,3-dimethyl-2-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]indol-1-ium (PubChem CID 23534262) has the molecular formula C26H33N2+ and a molecular weight of 373.56 g/mol. Its IUPAC name is 1-butyl-3,3-dimethyl-2-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]indol-1-ium.
| Compound Name | 1-butyl-3,3-dimethyl-2-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]indol-1-ium |
|---|---|
| PubChem CID | 23534262 |
| Molecular Formula | C26H33N2+ |
| Molecular Weight | 373.56 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 1-butyl-3,3-dimethyl-2-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]indol-1-ium |
| SMILES | CCCC[N+]1=C(/C=C/c2ccc(N3CCCC3)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C26H33N2/c1-4-5-20-28-24-11-7-6-10-23(24)26(2,3)25(28)17-14-21-12-15-22(16-13-21)27-18-8-9-19-27/h6-7,10-17H,4-5,8-9,18-20H2,1-3H3/q+1 |
| InChIKey | BRGNJVJKAVJGRB-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|