C27H35N2O3S+ — CID 74060203
methyl 4-[3,3-dimethyl-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]indol-1-ium-1-yl]butane-1-sulfonate (PubChem CID 74060203) has the molecular formula C27H35N2O3S+ and a molecular weight of 467.66 g/mol. Its IUPAC name is methyl 4-[3,3-dimethyl-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]indol-1-ium-1-yl]butane-1-sulfonate.
| Compound Name | methyl 4-[3,3-dimethyl-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]indol-1-ium-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 74060203 |
| Molecular Formula | C27H35N2O3S+ |
| Molecular Weight | 467.66 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | methyl 4-[3,3-dimethyl-2-[2-(4-pyrrolidin-1-ylphenyl)ethenyl]indol-1-ium-1-yl]butane-1-sulfonate |
| SMILES | COS(=O)(=O)CCCC[N+]1=C(C=Cc2ccc(N3CCCC3)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C27H35N2O3S/c1-27(2)24-10-4-5-11-25(24)29(20-8-9-21-33(30,31)32-3)26(27)17-14-22-12-15-23(16-13-22)28-18-6-7-19-28/h4-5,10-17H,6-9,18-21H2,1-3H3/q+1 |
| InChIKey | TYCROHIEXQNZAR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 49.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.66 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|