C43H39NO5S — CID 162719892
4-[5-carboxy-3,3-dimethyl-2-[(E)-2-[4-(1,2,2-triphenylethenyl)phenyl]ethenyl]indol-1-ium-1-yl]butane-1-sulfonate (PubChem CID 162719892) has the molecular formula C43H39NO5S and a molecular weight of 681.85 g/mol. Its IUPAC name is 4-[5-carboxy-3,3-dimethyl-2-[(E)-2-[4-(1,2,2-triphenylethenyl)phenyl]ethenyl]indol-1-ium-1-yl]butane-1-sulfonate.
| Compound Name | 4-[5-carboxy-3,3-dimethyl-2-[(E)-2-[4-(1,2,2-triphenylethenyl)phenyl]ethenyl]indol-1-ium-1-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 162719892 |
| Molecular Formula | C43H39NO5S |
| Molecular Weight | 681.85 g/mol |
| Exact Mass | 681.25 |
| IUPAC Name | 4-[5-carboxy-3,3-dimethyl-2-[(E)-2-[4-(1,2,2-triphenylethenyl)phenyl]ethenyl]indol-1-ium-1-yl]butane-1-sulfonate |
| SMILES | CC1(C)C(/C=C/c2ccc(C(=C(c3ccccc3)c3ccccc3)c3ccccc3)cc2)=[N+](CCCCS(=O)(=O)[O-])c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C43H39NO5S/c1-43(2)37-30-36(42(45)46)25-26-38(37)44(28-12-13-29-50(47,48)49)39(43)27-22-31-20-23-35(24-21-31)41(34-18-10-5-11-19-34)40(32-14-6-3-7-15-32)33-16-8-4-9-17-33/h3-11,14-27,30H,12-13,28-29H2,1-2H3,(H-,45,46,47,48,49)/b27-22+ |
| InChIKey | MYZQELXGSUXUOZ-HPNDGRJYSA-N |
| XLogP | 8.81 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.85 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|